C20H26ClN3O3S2 — CID 6591904
3-[[(3aS,6aR)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl]amino]-4-chloro-N-cyclooctylbenzamide (PubChem CID 6591904) has the molecular formula C20H26ClN3O3S2 and a molecular weight of 456.03 g/mol. Its IUPAC name is 3-[[(3aS,6aR)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl]amino]-4-chloro-N-cyclooctylbenzamide.
| Compound Name | 3-[[(3aS,6aR)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl]amino]-4-chloro-N-cyclooctylbenzamide |
|---|---|
| PubChem CID | 6591904 |
| Molecular Formula | C20H26ClN3O3S2 |
| Molecular Weight | 456.03 g/mol |
| Exact Mass | 455.11 |
| IUPAC Name | 3-[[(3aS,6aR)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl]amino]-4-chloro-N-cyclooctylbenzamide |
| SMILES | O=C(NC1CCCCCCC1)c1ccc(Cl)c(NC2=N[C@H]3CS(=O)(=O)C[C@@H]3S2)c1 |
| InChI | InChI=1S/C20H26ClN3O3S2/c21-15-9-8-13(19(25)22-14-6-4-2-1-3-5-7-14)10-16(15)23-20-24-17-11-29(26,27)12-18(17)28-20/h8-10,14,17-18H,1-7,11-12H2,(H,22,25)(H,23,24)/t17-,18-/m0/s1 |
| InChIKey | VOPDNXIZBQSRRY-ROUUACIJSA-N |
| XLogP | 3.86 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.03 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |