C24H31N3O3S2 — CID 46369246
N-[1-(1-adamantyl)ethyl]-4-[(5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl)amino]benzamide (PubChem CID 46369246) has the molecular formula C24H31N3O3S2 and a molecular weight of 473.66 g/mol. Its IUPAC name is N-[1-(1-adamantyl)ethyl]-4-[(5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl)amino]benzamide.
| Compound Name | N-[1-(1-adamantyl)ethyl]-4-[(5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl)amino]benzamide |
|---|---|
| PubChem CID | 46369246 |
| Molecular Formula | C24H31N3O3S2 |
| Molecular Weight | 473.66 g/mol |
| Exact Mass | 473.18 |
| IUPAC Name | N-[1-(1-adamantyl)ethyl]-4-[(5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl)amino]benzamide |
| SMILES | CC(NC(=O)c1ccc(NC2=NC3CS(=O)(=O)CC3S2)cc1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C24H31N3O3S2/c1-14(24-9-15-6-16(10-24)8-17(7-15)11-24)25-22(28)18-2-4-19(5-3-18)26-23-27-20-12-32(29,30)13-21(20)31-23/h2-5,14-17,20-21H,6-13H2,1H3,(H,25,28)(H,26,27) |
| InChIKey | KDBQTITYWOTDDU-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.66 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |