C22H23ClN4O3S2 — CID 22588440
[4-(3-chlorophenyl)piperazin-1-yl]-[4-[(5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl)amino]phenyl]methanone (PubChem CID 22588440) has the molecular formula C22H23ClN4O3S2 and a molecular weight of 491.04 g/mol. Its IUPAC name is [4-(3-chlorophenyl)piperazin-1-yl]-[4-[(5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl)amino]phenyl]methanone.
| Compound Name | [4-(3-chlorophenyl)piperazin-1-yl]-[4-[(5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl)amino]phenyl]methanone |
|---|---|
| PubChem CID | 22588440 |
| Molecular Formula | C22H23ClN4O3S2 |
| Molecular Weight | 491.04 g/mol |
| Exact Mass | 490.09 |
| IUPAC Name | [4-(3-chlorophenyl)piperazin-1-yl]-[4-[(5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl)amino]phenyl]methanone |
| SMILES | O=C(c1ccc(NC2=NC3CS(=O)(=O)CC3S2)cc1)N1CCN(c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C22H23ClN4O3S2/c23-16-2-1-3-18(12-16)26-8-10-27(11-9-26)21(28)15-4-6-17(7-5-15)24-22-25-19-13-32(29,30)14-20(19)31-22/h1-7,12,19-20H,8-11,13-14H2,(H,24,25) |
| InChIKey | MGOYCSASQSNWRI-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 82.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.04 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |