C22H32N4O3S2 — CID 124770213
[3-[[(3aR,6aS)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl]amino]-4-methylphenyl]-[4-[(2S)-pentan-2-yl]piperazin-1-yl]methanone (PubChem CID 124770213) has the molecular formula C22H32N4O3S2 and a molecular weight of 464.66 g/mol. Its IUPAC name is [3-[[(3aR,6aS)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl]amino]-4-methylphenyl]-[4-[(2S)-pentan-2-yl]piperazin-1-yl]methanone.
| Compound Name | [3-[[(3aR,6aS)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl]amino]-4-methylphenyl]-[4-[(2S)-pentan-2-yl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 124770213 |
| Molecular Formula | C22H32N4O3S2 |
| Molecular Weight | 464.66 g/mol |
| Exact Mass | 464.19 |
| IUPAC Name | [3-[[(3aR,6aS)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-yl]amino]-4-methylphenyl]-[4-[(2S)-pentan-2-yl]piperazin-1-yl]methanone |
| SMILES | CCC[C@H](C)N1CCN(C(=O)c2ccc(C)c(NC3=N[C@@H]4CS(=O)(=O)C[C@H]4S3)c2)CC1 |
| InChI | InChI=1S/C22H32N4O3S2/c1-4-5-16(3)25-8-10-26(11-9-25)21(27)17-7-6-15(2)18(12-17)23-22-24-19-13-31(28,29)14-20(19)30-22/h6-7,12,16,19-20H,4-5,8-11,13-14H2,1-3H3,(H,23,24)/t16-,19+,20+/m0/s1 |
| InChIKey | KNZLJLNOCQFVSX-PWIZWCRZSA-N |
| XLogP | 2.62 |
| TPSA | 82.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.66 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |