C12H11Cl2N3O2S2 — CID 124576890
(3aR,6aS)-3-[(Z)-(2,6-dichlorophenyl)methylideneamino]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-imine (PubChem CID 124576890) has the molecular formula C12H11Cl2N3O2S2 and a molecular weight of 364.28 g/mol. Its IUPAC name is (3aR,6aS)-3-[(Z)-(2,6-dichlorophenyl)methylideneamino]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-imine.
| Compound Name | (3aR,6aS)-3-[(Z)-(2,6-dichlorophenyl)methylideneamino]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-imine |
|---|---|
| PubChem CID | 124576890 |
| Molecular Formula | C12H11Cl2N3O2S2 |
| Molecular Weight | 364.28 g/mol |
| Exact Mass | 362.97 |
| IUPAC Name | (3aR,6aS)-3-[(Z)-(2,6-dichlorophenyl)methylideneamino]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-imine |
| SMILES | [H]/N=C1\S[C@@H]2CS(=O)(=O)C[C@H]2N1/N=C\c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C12H11Cl2N3O2S2/c13-8-2-1-3-9(14)7(8)4-16-17-10-5-21(18,19)6-11(10)20-12(17)15/h1-4,10-11,15H,5-6H2/b15-12-,16-4-/t10-,11-/m1/s1 |
| InChIKey | LORUPXIIOJNQSW-URQDKQRRSA-N |
| XLogP | 2.48 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.28 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|