C20H29N3O3S2 — CID 137078103
4-[[(3aS,6aS)-2-imino-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-3-yl]iminomethyl]-2,6-ditert-butylphenol (PubChem CID 137078103) has the molecular formula C20H29N3O3S2 and a molecular weight of 423.60 g/mol. Its IUPAC name is 4-[[(3aS,6aS)-2-imino-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-3-yl]iminomethyl]-2,6-ditert-butylphenol.
| Compound Name | 4-[[(3aS,6aS)-2-imino-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-3-yl]iminomethyl]-2,6-ditert-butylphenol |
|---|---|
| PubChem CID | 137078103 |
| Molecular Formula | C20H29N3O3S2 |
| Molecular Weight | 423.60 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | 4-[[(3aS,6aS)-2-imino-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-3-yl]iminomethyl]-2,6-ditert-butylphenol |
| SMILES | [H]/N=C1\S[C@@H]2CS(=O)(=O)C[C@@H]2N1N=Cc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C20H29N3O3S2/c1-19(2,3)13-7-12(8-14(17(13)24)20(4,5)6)9-22-23-15-10-28(25,26)11-16(15)27-18(23)21/h7-9,15-16,21,24H,10-11H2,1-6H3/b21-18-,22-9?/t15-,16+/m0/s1 |
| InChIKey | UHZLZTIVWTXICI-LKSFBGGCSA-N |
| XLogP | 3.47 |
| TPSA | 93.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.60 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|