C14H18N2O4S2 — CID 98446778
(3aS,6aS)-3-[(3,4-dimethoxyphenyl)methyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-imine (PubChem CID 98446778) has the molecular formula C14H18N2O4S2 and a molecular weight of 342.44 g/mol. Its IUPAC name is (3aS,6aS)-3-[(3,4-dimethoxyphenyl)methyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-imine.
| Compound Name | (3aS,6aS)-3-[(3,4-dimethoxyphenyl)methyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-imine |
|---|---|
| PubChem CID | 98446778 |
| Molecular Formula | C14H18N2O4S2 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | (3aS,6aS)-3-[(3,4-dimethoxyphenyl)methyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-imine |
| SMILES | [H]/N=C1\S[C@@H]2CS(=O)(=O)C[C@@H]2N1Cc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C14H18N2O4S2/c1-19-11-4-3-9(5-12(11)20-2)6-16-10-7-22(17,18)8-13(10)21-14(16)15/h3-5,10,13,15H,6-8H2,1-2H3/b15-14-/t10-,13+/m0/s1 |
| InChIKey | KPEUHEPSDOSTDO-FJKVVAJXSA-N |
| XLogP | 1.35 |
| TPSA | 79.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|