C13H14N2O4S2 — CID 11907818
(3aS,6aR)-3-(1,3-benzodioxol-5-ylmethyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-imine (PubChem CID 11907818) has the molecular formula C13H14N2O4S2 and a molecular weight of 326.40 g/mol. Its IUPAC name is (3aS,6aR)-3-(1,3-benzodioxol-5-ylmethyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-imine.
| Compound Name | (3aS,6aR)-3-(1,3-benzodioxol-5-ylmethyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-imine |
|---|---|
| PubChem CID | 11907818 |
| Molecular Formula | C13H14N2O4S2 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.04 |
| IUPAC Name | (3aS,6aR)-3-(1,3-benzodioxol-5-ylmethyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-imine |
| SMILES | [H]/N=C1\S[C@H]2CS(=O)(=O)C[C@@H]2N1Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C13H14N2O4S2/c14-13-15(9-5-21(16,17)6-12(9)20-13)4-8-1-2-10-11(3-8)19-7-18-10/h1-3,9,12,14H,4-7H2/b14-13-/t9-,12-/m0/s1 |
| InChIKey | OIQLFBDPJBYVPE-AKWBAMEGSA-N |
| XLogP | 1.06 |
| TPSA | 79.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|