C13H17BrN2O4S2 — CID 52994898
3-(3,4-dimethoxyphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-imine;hydrobromide (PubChem CID 52994898) has the molecular formula C13H17BrN2O4S2 and a molecular weight of 409.33 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-imine;hydrobromide.
| Compound Name | 3-(3,4-dimethoxyphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-imine;hydrobromide |
|---|---|
| PubChem CID | 52994898 |
| Molecular Formula | C13H17BrN2O4S2 |
| Molecular Weight | 409.33 g/mol |
| Exact Mass | 407.98 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-imine;hydrobromide |
| SMILES | Br.[H]/N=C1\SC2CS(=O)(=O)CC2N1c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C13H16N2O4S2.BrH/c1-18-10-4-3-8(5-11(10)19-2)15-9-6-21(16,17)7-12(9)20-13(15)14;/h3-5,9,12,14H,6-7H2,1-2H3;1H/b14-13-; |
| InChIKey | DDXVZSFFEGNOOR-HPWRNOGASA-N |
| XLogP | 1.94 |
| TPSA | 79.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.33 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|