C13H17BrN2O3S2 — CID 146051989
3-(2-ethoxyphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-imine;hydrobromide (PubChem CID 146051989) has the molecular formula C13H17BrN2O3S2 and a molecular weight of 393.33 g/mol. Its IUPAC name is 3-(2-ethoxyphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-imine;hydrobromide.
| Compound Name | 3-(2-ethoxyphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-imine;hydrobromide |
|---|---|
| PubChem CID | 146051989 |
| Molecular Formula | C13H17BrN2O3S2 |
| Molecular Weight | 393.33 g/mol |
| Exact Mass | 391.99 |
| IUPAC Name | 3-(2-ethoxyphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-imine;hydrobromide |
| SMILES | Br.[H]/N=C1\SC2CS(=O)(=O)CC2N1c1ccccc1OCC |
| InChI | InChI=1S/C13H16N2O3S2.BrH/c1-2-18-11-6-4-3-5-9(11)15-10-7-20(16,17)8-12(10)19-13(15)14;/h3-6,10,12,14H,2,7-8H2,1H3;1H/b14-13-; |
| InChIKey | XTWIZCOLHZJUHT-HPWRNOGASA-N |
| XLogP | 2.32 |
| TPSA | 70.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.33 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|