C11H12BrFN2O2S2 — CID 52994968
3-(2-fluorophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-imine;hydrobromide (PubChem CID 52994968) has the molecular formula C11H12BrFN2O2S2 and a molecular weight of 367.27 g/mol. Its IUPAC name is 3-(2-fluorophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-imine;hydrobromide.
| Compound Name | 3-(2-fluorophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-imine;hydrobromide |
|---|---|
| PubChem CID | 52994968 |
| Molecular Formula | C11H12BrFN2O2S2 |
| Molecular Weight | 367.27 g/mol |
| Exact Mass | 365.95 |
| IUPAC Name | 3-(2-fluorophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-imine;hydrobromide |
| SMILES | Br.[H]/N=C1\SC2CS(=O)(=O)CC2N1c1ccccc1F |
| InChI | InChI=1S/C11H11FN2O2S2.BrH/c12-7-3-1-2-4-8(7)14-9-5-18(15,16)6-10(9)17-11(14)13;/h1-4,9-10,13H,5-6H2;1H/b13-11-; |
| InChIKey | MPDRXWYETPCPND-KEHAOADBSA-N |
| XLogP | 2.06 |
| TPSA | 61.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.27 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|