C12H14N2O2S3 — CID 11911310
(3aR,6aR)-3-(2-methylsulfanylphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-imine (PubChem CID 11911310) has the molecular formula C12H14N2O2S3 and a molecular weight of 314.46 g/mol. Its IUPAC name is (3aR,6aR)-3-(2-methylsulfanylphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-imine.
| Compound Name | (3aR,6aR)-3-(2-methylsulfanylphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-imine |
|---|---|
| PubChem CID | 11911310 |
| Molecular Formula | C12H14N2O2S3 |
| Molecular Weight | 314.46 g/mol |
| Exact Mass | 314.02 |
| IUPAC Name | (3aR,6aR)-3-(2-methylsulfanylphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-imine |
| SMILES | [H]/N=C1\S[C@H]2CS(=O)(=O)C[C@H]2N1c1ccccc1SC |
| InChI | InChI=1S/C12H14N2O2S3/c1-17-10-5-3-2-4-8(10)14-9-6-19(15,16)7-11(9)18-12(14)13/h2-5,9,11,13H,6-7H2,1H3/b13-12-/t9-,11+/m1/s1 |
| InChIKey | DYTFRJSLSYOEAV-HKBRYTGKSA-N |
| XLogP | 2.06 |
| TPSA | 61.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.46 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|