C5H9N3O2S2 — CID 11879062
(3aR,6aS)-2-imino-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-3-amine (PubChem CID 11879062) has the molecular formula C5H9N3O2S2 and a molecular weight of 207.28 g/mol. Its IUPAC name is (3aR,6aS)-2-imino-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-3-amine.
| Compound Name | (3aR,6aS)-2-imino-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-3-amine |
|---|---|
| PubChem CID | 11879062 |
| Molecular Formula | C5H9N3O2S2 |
| Molecular Weight | 207.28 g/mol |
| Exact Mass | 207.01 |
| IUPAC Name | (3aR,6aS)-2-imino-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-3-amine |
| SMILES | [H]/N=C1\S[C@@H]2CS(=O)(=O)C[C@H]2N1N |
| InChI | InChI=1S/C5H9N3O2S2/c6-5-8(7)3-1-12(9,10)2-4(3)11-5/h3-4,6H,1-2,7H2/b6-5-/t3-,4-/m1/s1 |
| InChIKey | PNKBMYSSZZRQHP-DMAKOYSDSA-N |
| XLogP | -0.99 |
| TPSA | 87.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.28 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|