C13H14N2O3S2 — CID 11905138
2-[(3aS,6aR)-2-imino-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-3-yl]-1-phenylethanone (PubChem CID 11905138) has the molecular formula C13H14N2O3S2 and a molecular weight of 310.40 g/mol. Its IUPAC name is 2-[(3aS,6aR)-2-imino-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-3-yl]-1-phenylethanone.
| Compound Name | 2-[(3aS,6aR)-2-imino-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-3-yl]-1-phenylethanone |
|---|---|
| PubChem CID | 11905138 |
| Molecular Formula | C13H14N2O3S2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.04 |
| IUPAC Name | 2-[(3aS,6aR)-2-imino-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-3-yl]-1-phenylethanone |
| SMILES | [H]/N=C1\S[C@H]2CS(=O)(=O)C[C@@H]2N1CC(=O)c1ccccc1 |
| InChI | InChI=1S/C13H14N2O3S2/c14-13-15(6-11(16)9-4-2-1-3-5-9)10-7-20(17,18)8-12(10)19-13/h1-5,10,12,14H,6-8H2/b14-13-/t10-,12-/m0/s1 |
| InChIKey | XGFAGMHTCRTIIH-RNNWNBAISA-N |
| XLogP | 1.02 |
| TPSA | 78.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|