C18H19BrN2OS — CID 161308037
2-(2-imino-4-methyl-5-phenyl-1,3-thiazolidin-3-yl)-1-phenylethanone;hydrobromide (PubChem CID 161308037) has the molecular formula C18H19BrN2OS and a molecular weight of 391.33 g/mol. Its IUPAC name is 2-(2-imino-4-methyl-5-phenyl-1,3-thiazolidin-3-yl)-1-phenylethanone;hydrobromide.
| Compound Name | 2-(2-imino-4-methyl-5-phenyl-1,3-thiazolidin-3-yl)-1-phenylethanone;hydrobromide |
|---|---|
| PubChem CID | 161308037 |
| Molecular Formula | C18H19BrN2OS |
| Molecular Weight | 391.33 g/mol |
| Exact Mass | 390.04 |
| IUPAC Name | 2-(2-imino-4-methyl-5-phenyl-1,3-thiazolidin-3-yl)-1-phenylethanone;hydrobromide |
| SMILES | Br.[H]/N=C1\SC(c2ccccc2)C(C)N1CC(=O)c1ccccc1 |
| InChI | InChI=1S/C18H18N2OS.BrH/c1-13-17(15-10-6-3-7-11-15)22-18(19)20(13)12-16(21)14-8-4-2-5-9-14;/h2-11,13,17,19H,12H2,1H3;1H/b19-18-; |
| InChIKey | VINBOSJKEGSZSC-TVWXOORISA-N |
| XLogP | 4.56 |
| TPSA | 44.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.33 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|