C15H21BrN2O4S2 — CID 173262665
(3aR,6aR)-3-[2-(3,4-dimethoxyphenyl)ethyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-imine;hydrobromide (PubChem CID 173262665) has the molecular formula C15H21BrN2O4S2 and a molecular weight of 437.38 g/mol. Its IUPAC name is (3aR,6aR)-3-[2-(3,4-dimethoxyphenyl)ethyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-imine;hydrobromide.
| Compound Name | (3aR,6aR)-3-[2-(3,4-dimethoxyphenyl)ethyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-imine;hydrobromide |
|---|---|
| PubChem CID | 173262665 |
| Molecular Formula | C15H21BrN2O4S2 |
| Molecular Weight | 437.38 g/mol |
| Exact Mass | 436.01 |
| IUPAC Name | (3aR,6aR)-3-[2-(3,4-dimethoxyphenyl)ethyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-imine;hydrobromide |
| SMILES | Br.[H]/N=C1\S[C@H]2CS(=O)(=O)C[C@H]2N1CCc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C15H20N2O4S2.BrH/c1-20-12-4-3-10(7-13(12)21-2)5-6-17-11-8-23(18,19)9-14(11)22-15(17)16;/h3-4,7,11,14,16H,5-6,8-9H2,1-2H3;1H/b16-15-;/t11-,14+;/m1./s1 |
| InChIKey | DDQSHUUGJPMOCT-HZZQNXLZSA-N |
| XLogP | 1.97 |
| TPSA | 79.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.38 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|