C7H12N2O2S2 — CID 9122940
(3aS,6aR)-3-ethyl-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-imine (PubChem CID 9122940) has the molecular formula C7H12N2O2S2 and a molecular weight of 220.32 g/mol. Its IUPAC name is (3aS,6aR)-3-ethyl-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-imine.
| Compound Name | (3aS,6aR)-3-ethyl-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-imine |
|---|---|
| PubChem CID | 9122940 |
| Molecular Formula | C7H12N2O2S2 |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.03 |
| IUPAC Name | (3aS,6aR)-3-ethyl-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-imine |
| SMILES | [H]/N=C1\S[C@H]2CS(=O)(=O)C[C@@H]2N1CC |
| InChI | InChI=1S/C7H12N2O2S2/c1-2-9-5-3-13(10,11)4-6(5)12-7(9)8/h5-6,8H,2-4H2,1H3/b8-7-/t5-,6-/m0/s1 |
| InChIKey | WXWSBOCSTJJHJK-PZDQFLETSA-N |
| XLogP | 0.16 |
| TPSA | 61.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|