C12H22N2S — CID 136867396
4-ethyl-N-[(3-methylcyclopentyl)methyl]-1,3-thiazolidin-2-imine (PubChem CID 136867396) has the molecular formula C12H22N2S and a molecular weight of 226.39 g/mol. Its IUPAC name is 4-ethyl-N-[(3-methylcyclopentyl)methyl]-1,3-thiazolidin-2-imine.
| Compound Name | 4-ethyl-N-[(3-methylcyclopentyl)methyl]-1,3-thiazolidin-2-imine |
|---|---|
| PubChem CID | 136867396 |
| Molecular Formula | C12H22N2S |
| Molecular Weight | 226.39 g/mol |
| Exact Mass | 226.15 |
| IUPAC Name | 4-ethyl-N-[(3-methylcyclopentyl)methyl]-1,3-thiazolidin-2-imine |
| SMILES | CCC1CS/C(=N\CC2CCC(C)C2)N1 |
| InChI | InChI=1S/C12H22N2S/c1-3-11-8-15-12(14-11)13-7-10-5-4-9(2)6-10/h9-11H,3-8H2,1-2H3,(H,13,14) |
| InChIKey | XTQUHXUEFXPDHH-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.39 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|