C17H20N2S — CID 136871766
N-(naphthalen-1-ylmethyl)-4-propan-2-yl-1,3-thiazolidin-2-imine (PubChem CID 136871766) has the molecular formula C17H20N2S and a molecular weight of 284.43 g/mol. Its IUPAC name is N-(naphthalen-1-ylmethyl)-4-propan-2-yl-1,3-thiazolidin-2-imine.
| Compound Name | N-(naphthalen-1-ylmethyl)-4-propan-2-yl-1,3-thiazolidin-2-imine |
|---|---|
| PubChem CID | 136871766 |
| Molecular Formula | C17H20N2S |
| Molecular Weight | 284.43 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | N-(naphthalen-1-ylmethyl)-4-propan-2-yl-1,3-thiazolidin-2-imine |
| SMILES | CC(C)C1CS/C(=N\Cc2cccc3ccccc23)N1 |
| InChI | InChI=1S/C17H20N2S/c1-12(2)16-11-20-17(19-16)18-10-14-8-5-7-13-6-3-4-9-15(13)14/h3-9,12,16H,10-11H2,1-2H3,(H,18,19) |
| InChIKey | VYUDPVBMADGCJA-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.43 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|