C15H19F3N2S — CID 136848013
4-propan-2-yl-N-[[3-(trifluoromethyl)phenyl]methyl]-1,3-thiazinan-2-imine (PubChem CID 136848013) has the molecular formula C15H19F3N2S and a molecular weight of 316.39 g/mol. Its IUPAC name is 4-propan-2-yl-N-[[3-(trifluoromethyl)phenyl]methyl]-1,3-thiazinan-2-imine.
| Compound Name | 4-propan-2-yl-N-[[3-(trifluoromethyl)phenyl]methyl]-1,3-thiazinan-2-imine |
|---|---|
| PubChem CID | 136848013 |
| Molecular Formula | C15H19F3N2S |
| Molecular Weight | 316.39 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | 4-propan-2-yl-N-[[3-(trifluoromethyl)phenyl]methyl]-1,3-thiazinan-2-imine |
| SMILES | CC(C)C1CCS/C(=N\Cc2cccc(C(F)(F)F)c2)N1 |
| InChI | InChI=1S/C15H19F3N2S/c1-10(2)13-6-7-21-14(20-13)19-9-11-4-3-5-12(8-11)15(16,17)18/h3-5,8,10,13H,6-7,9H2,1-2H3,(H,19,20) |
| InChIKey | AWTQRSIBHMAMGN-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.39 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|