C14H21N3S — CID 136848100
4-propan-2-yl-N-(2-pyridin-4-ylethyl)-1,3-thiazinan-2-imine (PubChem CID 136848100) has the molecular formula C14H21N3S and a molecular weight of 263.41 g/mol. Its IUPAC name is 4-propan-2-yl-N-(2-pyridin-4-ylethyl)-1,3-thiazinan-2-imine.
| Compound Name | 4-propan-2-yl-N-(2-pyridin-4-ylethyl)-1,3-thiazinan-2-imine |
|---|---|
| PubChem CID | 136848100 |
| Molecular Formula | C14H21N3S |
| Molecular Weight | 263.41 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | 4-propan-2-yl-N-(2-pyridin-4-ylethyl)-1,3-thiazinan-2-imine |
| SMILES | CC(C)C1CCS/C(=N\CCc2ccncc2)N1 |
| InChI | InChI=1S/C14H21N3S/c1-11(2)13-6-10-18-14(17-13)16-9-5-12-3-7-15-8-4-12/h3-4,7-8,11,13H,5-6,9-10H2,1-2H3,(H,16,17) |
| InChIKey | FFCBUQAXTBOCTQ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.41 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|