About bis(2-phenoxyethyl) bis[1-(4-propan-2-ylcyclohexyl)ethyl] silicate
bis(2-phenoxyethyl) bis[1-(4-propan-2-ylcyclohexyl)ethyl] silicate (PubChem CID 53327852) has the molecular formula C38H60O6Si
and a molecular weight of 640.98 g/mol. Its IUPAC name is bis(2-phenoxyethyl) bis[1-(4-propan-2-ylcyclohexyl)ethyl] silicate.
Molecular Properties
| Compound Name | bis(2-phenoxyethyl) bis[1-(4-propan-2-ylcyclohexyl)ethyl] silicate |
| PubChem CID | 53327852 |
| Molecular Formula | C38H60O6Si |
| Molecular Weight | 640.98 g/mol |
| Exact Mass | 640.42 |
| IUPAC Name | bis(2-phenoxyethyl) bis[1-(4-propan-2-ylcyclohexyl)ethyl] silicate |
| SMILES | CC(C)C1CCC(C(C)O[Si](OCCOc2ccccc2)(OCCOc2ccccc2)OC(C)C2CCC(C(C)C)CC2)CC1 |
| InChI | InChI=1S/C38H60O6Si/c1-29(2)33-17-21-35(22-18-33)31(5)43-45(41-27-25-39-37-13-9-7-10-14-37,42-28-26-40-38-15-11-8-12-16-38)44-32(6)36-23-19-34(20-24-36)30(3)4/h7-16,29-36H,17-28H2,1-6H3 |
| InChIKey | NZUISNIUGDPJMZ-UHFFFAOYSA-N |
| XLogP | 9.35 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 640.98 |
| LogP ≤ 5 | 9.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze bis(2-phenoxyethyl) bis[1-(4-propan-2-ylcyclohexyl)ethyl] silicate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-phenoxyethyl) bis[1-(4-propan-2-ylcyclohexyl)ethyl] silicate?
The IUPAC name of bis(2-phenoxyethyl) bis[1-(4-propan-2-ylcyclohexyl)ethyl] silicate (CID 53327852) is bis(2-phenoxyethyl) bis[1-(4-propan-2-ylcyclohexyl)ethyl] silicate.
What is the SMILES notation for bis(2-phenoxyethyl) bis[1-(4-propan-2-ylcyclohexyl)ethyl] silicate?
The canonical SMILES for bis(2-phenoxyethyl) bis[1-(4-propan-2-ylcyclohexyl)ethyl] silicate is CC(C)C1CCC(C(C)O[Si](OCCOc2ccccc2)(OCCOc2ccccc2)OC(C)C2CCC(C(C)C)CC2)CC1.
What is the InChIKey of bis(2-phenoxyethyl) bis[1-(4-propan-2-ylcyclohexyl)ethyl] silicate?
The InChIKey is NZUISNIUGDPJMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C38H60O6Si/c1-29(2)33-17-21-35(22-18-33)31(5)43-45(41-27-25-39-37-13-9-7-10-14-37,42-28-26-40-38-15-11-8-12-16-38)44-32(6)36-23-19-34(20-24-36)30(3)4/h7-16,29-36H,17-28H2,1-6H3.
What are the key properties of bis(2-phenoxyethyl) bis[1-(4-propan-2-ylcyclohexyl)ethyl] silicate?
bis(2-phenoxyethyl) bis[1-(4-propan-2-ylcyclohexyl)ethyl] silicate has a molecular weight of 640.98 g/mol, XLogP of 9.35, 18 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-phenoxyethyl) bis[1-(4-propan-2-ylcyclohexyl)ethyl] silicate is sourced from PubChem (CID 53327852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).