C11H21N3OS — CID 136666952
N-ethyl-N-methyl-2-[(4-propan-2-yl-1,3-thiazolidin-2-ylidene)amino]acetamide (PubChem CID 136666952) has the molecular formula C11H21N3OS and a molecular weight of 243.38 g/mol. Its IUPAC name is N-ethyl-N-methyl-2-[(4-propan-2-yl-1,3-thiazolidin-2-ylidene)amino]acetamide.
| Compound Name | N-ethyl-N-methyl-2-[(4-propan-2-yl-1,3-thiazolidin-2-ylidene)amino]acetamide |
|---|---|
| PubChem CID | 136666952 |
| Molecular Formula | C11H21N3OS |
| Molecular Weight | 243.38 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | N-ethyl-N-methyl-2-[(4-propan-2-yl-1,3-thiazolidin-2-ylidene)amino]acetamide |
| SMILES | CCN(C)C(=O)C/N=C1/NC(C(C)C)CS1 |
| InChI | InChI=1S/C11H21N3OS/c1-5-14(4)10(15)6-12-11-13-9(7-16-11)8(2)3/h8-9H,5-7H2,1-4H3,(H,12,13) |
| InChIKey | ZJOJGGIKCVQEEO-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.38 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|