C11H20N2O2S — CID 136871756
ethyl 3-[(4-propan-2-yl-1,3-thiazolidin-2-ylidene)amino]propanoate (PubChem CID 136871756) has the molecular formula C11H20N2O2S and a molecular weight of 244.36 g/mol. Its IUPAC name is ethyl 3-[(4-propan-2-yl-1,3-thiazolidin-2-ylidene)amino]propanoate.
| Compound Name | ethyl 3-[(4-propan-2-yl-1,3-thiazolidin-2-ylidene)amino]propanoate |
|---|---|
| PubChem CID | 136871756 |
| Molecular Formula | C11H20N2O2S |
| Molecular Weight | 244.36 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | ethyl 3-[(4-propan-2-yl-1,3-thiazolidin-2-ylidene)amino]propanoate |
| SMILES | CCOC(=O)CC/N=C1/NC(C(C)C)CS1 |
| InChI | InChI=1S/C11H20N2O2S/c1-4-15-10(14)5-6-12-11-13-9(7-16-11)8(2)3/h8-9H,4-7H2,1-3H3,(H,12,13) |
| InChIKey | MMUJURGXXRIYAS-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.36 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|