C15H26N4 — CID 62949584
1-dodecyl-1,2,4-triazole-3-carbonitrile (PubChem CID 62949584) has the molecular formula C15H26N4 and a molecular weight of 262.40 g/mol. Its IUPAC name is 1-dodecyl-1,2,4-triazole-3-carbonitrile.
| Compound Name | 1-dodecyl-1,2,4-triazole-3-carbonitrile |
|---|---|
| PubChem CID | 62949584 |
| Molecular Formula | C15H26N4 |
| Molecular Weight | 262.40 g/mol |
| Exact Mass | 262.22 |
| IUPAC Name | 1-dodecyl-1,2,4-triazole-3-carbonitrile |
| SMILES | CCCCCCCCCCCCn1cnc(C#N)n1 |
| InChI | InChI=1S/C15H26N4/c1-2-3-4-5-6-7-8-9-10-11-12-19-14-17-15(13-16)18-19/h14H,2-12H2,1H3 |
| InChIKey | FOJKRYYKEJHWIZ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 54.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.40 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|