C11H18N4 — CID 60779043
1-(2-ethylhexyl)-1,2,4-triazole-3-carbonitrile (PubChem CID 60779043) has the molecular formula C11H18N4 and a molecular weight of 206.29 g/mol. Its IUPAC name is 1-(2-ethylhexyl)-1,2,4-triazole-3-carbonitrile.
| Compound Name | 1-(2-ethylhexyl)-1,2,4-triazole-3-carbonitrile |
|---|---|
| PubChem CID | 60779043 |
| Molecular Formula | C11H18N4 |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.15 |
| IUPAC Name | 1-(2-ethylhexyl)-1,2,4-triazole-3-carbonitrile |
| SMILES | CCCCC(CC)Cn1cnc(C#N)n1 |
| InChI | InChI=1S/C11H18N4/c1-3-5-6-10(4-2)8-15-9-13-11(7-12)14-15/h9-10H,3-6,8H2,1-2H3 |
| InChIKey | FWAQXAUZNUHMHL-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 54.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |