C10H19N3 — CID 63811004
1-(2-ethylhexyl)-1,2,4-triazole (PubChem CID 63811004) has the molecular formula C10H19N3 and a molecular weight of 181.28 g/mol. Its IUPAC name is 1-(2-ethylhexyl)-1,2,4-triazole.
| Compound Name | 1-(2-ethylhexyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 63811004 |
| Molecular Formula | C10H19N3 |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.16 |
| IUPAC Name | 1-(2-ethylhexyl)-1,2,4-triazole |
| SMILES | CCCCC(CC)Cn1cncn1 |
| InChI | InChI=1S/C10H19N3/c1-3-5-6-10(4-2)7-13-9-11-8-12-13/h8-10H,3-7H2,1-2H3 |
| InChIKey | ITAQIFWHZPDFBD-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |