C10H20N4 — CID 60911063
1-octyl-1,2,4-triazol-3-amine (PubChem CID 60911063) has the molecular formula C10H20N4 and a molecular weight of 196.30 g/mol. Its IUPAC name is 1-octyl-1,2,4-triazol-3-amine.
| Compound Name | 1-octyl-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 60911063 |
| Molecular Formula | C10H20N4 |
| Molecular Weight | 196.30 g/mol |
| Exact Mass | 196.17 |
| IUPAC Name | 1-octyl-1,2,4-triazol-3-amine |
| SMILES | CCCCCCCCn1cnc(N)n1 |
| InChI | InChI=1S/C10H20N4/c1-2-3-4-5-6-7-8-14-9-12-10(11)13-14/h9H,2-8H2,1H3,(H2,11,13) |
| InChIKey | WBKFRNUWCZBYSX-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.30 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|