About 1-hexyl-1,2,4-triazol-3-amine
1-hexyl-1,2,4-triazol-3-amine (PubChem CID 60910939) has the molecular formula C8H16N4
and a molecular weight of 168.24 g/mol. Its IUPAC name is 1-hexyl-1,2,4-triazol-3-amine.
Molecular Properties
| Compound Name | 1-hexyl-1,2,4-triazol-3-amine |
| PubChem CID | 60910939 |
| Molecular Formula | C8H16N4 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.14 |
| IUPAC Name | 1-hexyl-1,2,4-triazol-3-amine |
| SMILES | CCCCCCn1cnc(N)n1 |
| InChI | InChI=1S/C8H16N4/c1-2-3-4-5-6-12-7-10-8(9)11-12/h7H,2-6H2,1H3,(H2,9,11) |
| InChIKey | CPXQUBIXEAZBII-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-hexyl-1,2,4-triazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hexyl-1,2,4-triazol-3-amine?
The IUPAC name of 1-hexyl-1,2,4-triazol-3-amine (CID 60910939) is 1-hexyl-1,2,4-triazol-3-amine.
What is the SMILES notation for 1-hexyl-1,2,4-triazol-3-amine?
The canonical SMILES for 1-hexyl-1,2,4-triazol-3-amine is CCCCCCn1cnc(N)n1.
What is the InChIKey of 1-hexyl-1,2,4-triazol-3-amine?
The InChIKey is CPXQUBIXEAZBII-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N4/c1-2-3-4-5-6-12-7-10-8(9)11-12/h7H,2-6H2,1H3,(H2,9,11).
What are the key properties of 1-hexyl-1,2,4-triazol-3-amine?
1-hexyl-1,2,4-triazol-3-amine has a molecular weight of 168.24 g/mol, XLogP of 1.44, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hexyl-1,2,4-triazol-3-amine is sourced from PubChem (CID 60910939), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).