C8H16N4 — CID 60910939
1-hexyl-1,2,4-triazol-3-amine (PubChem CID 60910939) has the molecular formula C8H16N4 and a molecular weight of 168.24 g/mol. Its IUPAC name is 1-hexyl-1,2,4-triazol-3-amine.
| Compound Name | 1-hexyl-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 60910939 |
| Molecular Formula | C8H16N4 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.14 |
| IUPAC Name | 1-hexyl-1,2,4-triazol-3-amine |
| SMILES | CCCCCCn1cnc(N)n1 |
| InChI | InChI=1S/C8H16N4/c1-2-3-4-5-6-12-7-10-8(9)11-12/h7H,2-6H2,1H3,(H2,9,11) |
| InChIKey | CPXQUBIXEAZBII-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|