About 1-hexylpyrazole-3,4-diamine
1-hexylpyrazole-3,4-diamine (PubChem CID 122672209) has the molecular formula C9H18N4
and a molecular weight of 182.27 g/mol. Its IUPAC name is 1-hexylpyrazole-3,4-diamine.
Molecular Properties
| Compound Name | 1-hexylpyrazole-3,4-diamine |
| PubChem CID | 122672209 |
| Molecular Formula | C9H18N4 |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.15 |
| IUPAC Name | 1-hexylpyrazole-3,4-diamine |
| SMILES | CCCCCCn1cc(N)c(N)n1 |
| InChI | InChI=1S/C9H18N4/c1-2-3-4-5-6-13-7-8(10)9(11)12-13/h7H,2-6,10H2,1H3,(H2,11,12) |
| InChIKey | WJCPKAATOASNQX-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 69.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-hexylpyrazole-3,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hexylpyrazole-3,4-diamine?
The IUPAC name of 1-hexylpyrazole-3,4-diamine (CID 122672209) is 1-hexylpyrazole-3,4-diamine.
What is the SMILES notation for 1-hexylpyrazole-3,4-diamine?
The canonical SMILES for 1-hexylpyrazole-3,4-diamine is CCCCCCn1cc(N)c(N)n1.
What is the InChIKey of 1-hexylpyrazole-3,4-diamine?
The InChIKey is WJCPKAATOASNQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N4/c1-2-3-4-5-6-13-7-8(10)9(11)12-13/h7H,2-6,10H2,1H3,(H2,11,12).
What are the key properties of 1-hexylpyrazole-3,4-diamine?
1-hexylpyrazole-3,4-diamine has a molecular weight of 182.27 g/mol, XLogP of 1.63, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hexylpyrazole-3,4-diamine is sourced from PubChem (CID 122672209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).