C11H21N3O — CID 156537747
(1-octyl-1,2,4-triazol-3-yl)methanol (PubChem CID 156537747) has the molecular formula C11H21N3O and a molecular weight of 211.31 g/mol. Its IUPAC name is (1-octyl-1,2,4-triazol-3-yl)methanol.
| Compound Name | (1-octyl-1,2,4-triazol-3-yl)methanol |
|---|---|
| PubChem CID | 156537747 |
| Molecular Formula | C11H21N3O |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.17 |
| IUPAC Name | (1-octyl-1,2,4-triazol-3-yl)methanol |
| SMILES | CCCCCCCCn1cnc(CO)n1 |
| InChI | InChI=1S/C11H21N3O/c1-2-3-4-5-6-7-8-14-10-12-11(9-15)13-14/h10,15H,2-9H2,1H3 |
| InChIKey | VIMOLVCXMZZTHC-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|