C6H10FN3O — CID 81114047
[2-(3-fluoropropyl)-1,2,4-triazol-3-yl]methanol (PubChem CID 81114047) has the molecular formula C6H10FN3O and a molecular weight of 159.16 g/mol. Its IUPAC name is [2-(3-fluoropropyl)-1,2,4-triazol-3-yl]methanol.
| Compound Name | [2-(3-fluoropropyl)-1,2,4-triazol-3-yl]methanol |
|---|---|
| PubChem CID | 81114047 |
| Molecular Formula | C6H10FN3O |
| Molecular Weight | 159.16 g/mol |
| Exact Mass | 159.08 |
| IUPAC Name | [2-(3-fluoropropyl)-1,2,4-triazol-3-yl]methanol |
| SMILES | OCc1ncnn1CCCF |
| InChI | InChI=1S/C6H10FN3O/c7-2-1-3-10-6(4-11)8-5-9-10/h5,11H,1-4H2 |
| InChIKey | OLSAXWQRVVZCDD-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.16 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |