C9H17N3O3 — CID 103183861
[2-[2-(3-methoxypropoxy)ethyl]-1,2,4-triazol-3-yl]methanol (PubChem CID 103183861) has the molecular formula C9H17N3O3 and a molecular weight of 215.25 g/mol. Its IUPAC name is [2-[2-(3-methoxypropoxy)ethyl]-1,2,4-triazol-3-yl]methanol.
| Compound Name | [2-[2-(3-methoxypropoxy)ethyl]-1,2,4-triazol-3-yl]methanol |
|---|---|
| PubChem CID | 103183861 |
| Molecular Formula | C9H17N3O3 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | [2-[2-(3-methoxypropoxy)ethyl]-1,2,4-triazol-3-yl]methanol |
| SMILES | COCCCOCCn1ncnc1CO |
| InChI | InChI=1S/C9H17N3O3/c1-14-4-2-5-15-6-3-12-9(7-13)10-8-11-12/h8,13H,2-7H2,1H3 |
| InChIKey | PDEILXWRDFLFNY-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|