About [2-(2,2-difluoroethyl)-1,2,4-triazol-3-yl]methanol
[2-(2,2-difluoroethyl)-1,2,4-triazol-3-yl]methanol (PubChem CID 18406934) has the molecular formula C5H7F2N3O
and a molecular weight of 163.13 g/mol. Its IUPAC name is [2-(2,2-difluoroethyl)-1,2,4-triazol-3-yl]methanol.
Analyze [2-(2,2-difluoroethyl)-1,2,4-triazol-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2,2-difluoroethyl)-1,2,4-triazol-3-yl]methanol?
The IUPAC name of [2-(2,2-difluoroethyl)-1,2,4-triazol-3-yl]methanol (CID 18406934) is [2-(2,2-difluoroethyl)-1,2,4-triazol-3-yl]methanol.
What is the SMILES notation for [2-(2,2-difluoroethyl)-1,2,4-triazol-3-yl]methanol?
The canonical SMILES for [2-(2,2-difluoroethyl)-1,2,4-triazol-3-yl]methanol is OCc1ncnn1CC(F)F.
What is the InChIKey of [2-(2,2-difluoroethyl)-1,2,4-triazol-3-yl]methanol?
The InChIKey is UUHFGAPRERVWQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7F2N3O/c6-4(7)1-10-5(2-11)8-3-9-10/h3-4,11H,1-2H2.
What are the key properties of [2-(2,2-difluoroethyl)-1,2,4-triazol-3-yl]methanol?
[2-(2,2-difluoroethyl)-1,2,4-triazol-3-yl]methanol has a molecular weight of 163.13 g/mol, XLogP of 0.04, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2,2-difluoroethyl)-1,2,4-triazol-3-yl]methanol is sourced from PubChem (CID 18406934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).