About [2-(2-fluoropropyl)-1,2,4-triazol-3-yl]methanamine
[2-(2-fluoropropyl)-1,2,4-triazol-3-yl]methanamine (PubChem CID 84650765) has the molecular formula C6H11FN4
and a molecular weight of 158.18 g/mol. Its IUPAC name is [2-(2-fluoropropyl)-1,2,4-triazol-3-yl]methanamine.
Analyze [2-(2-fluoropropyl)-1,2,4-triazol-3-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2-fluoropropyl)-1,2,4-triazol-3-yl]methanamine?
The IUPAC name of [2-(2-fluoropropyl)-1,2,4-triazol-3-yl]methanamine (CID 84650765) is [2-(2-fluoropropyl)-1,2,4-triazol-3-yl]methanamine.
What is the SMILES notation for [2-(2-fluoropropyl)-1,2,4-triazol-3-yl]methanamine?
The canonical SMILES for [2-(2-fluoropropyl)-1,2,4-triazol-3-yl]methanamine is CC(F)Cn1ncnc1CN.
What is the InChIKey of [2-(2-fluoropropyl)-1,2,4-triazol-3-yl]methanamine?
The InChIKey is CRYQPVQIPZSAFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11FN4/c1-5(7)3-11-6(2-8)9-4-10-11/h4-5H,2-3,8H2,1H3.
What are the key properties of [2-(2-fluoropropyl)-1,2,4-triazol-3-yl]methanamine?
[2-(2-fluoropropyl)-1,2,4-triazol-3-yl]methanamine has a molecular weight of 158.18 g/mol, XLogP of 0.09, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2-fluoropropyl)-1,2,4-triazol-3-yl]methanamine is sourced from PubChem (CID 84650765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).