C13H27N5 — CID 105317619
[3-ethyl-1-[2-(2-methylpropyl)-1,2,4-triazol-3-yl]pentan-2-yl]hydrazine (PubChem CID 105317619) has the molecular formula C13H27N5 and a molecular weight of 253.39 g/mol. Its IUPAC name is [3-ethyl-1-[2-(2-methylpropyl)-1,2,4-triazol-3-yl]pentan-2-yl]hydrazine.
| Compound Name | [3-ethyl-1-[2-(2-methylpropyl)-1,2,4-triazol-3-yl]pentan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105317619 |
| Molecular Formula | C13H27N5 |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.23 |
| IUPAC Name | [3-ethyl-1-[2-(2-methylpropyl)-1,2,4-triazol-3-yl]pentan-2-yl]hydrazine |
| SMILES | CCC(CC)C(Cc1ncnn1CC(C)C)NN |
| InChI | InChI=1S/C13H27N5/c1-5-11(6-2)12(17-14)7-13-15-9-16-18(13)8-10(3)4/h9-12,17H,5-8,14H2,1-4H3 |
| InChIKey | VUJBYWZEDSKRFS-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|