C15H32N6 — CID 105239298
N,N-diethyl-3-hydrazinyl-2-methyl-4-[2-(2-methylpropyl)-1,2,4-triazol-3-yl]butan-2-amine (PubChem CID 105239298) has the molecular formula C15H32N6 and a molecular weight of 296.46 g/mol. Its IUPAC name is N,N-diethyl-3-hydrazinyl-2-methyl-4-[2-(2-methylpropyl)-1,2,4-triazol-3-yl]butan-2-amine.
| Compound Name | N,N-diethyl-3-hydrazinyl-2-methyl-4-[2-(2-methylpropyl)-1,2,4-triazol-3-yl]butan-2-amine |
|---|---|
| PubChem CID | 105239298 |
| Molecular Formula | C15H32N6 |
| Molecular Weight | 296.46 g/mol |
| Exact Mass | 296.27 |
| IUPAC Name | N,N-diethyl-3-hydrazinyl-2-methyl-4-[2-(2-methylpropyl)-1,2,4-triazol-3-yl]butan-2-amine |
| SMILES | CCN(CC)C(C)(C)C(Cc1ncnn1CC(C)C)NN |
| InChI | InChI=1S/C15H32N6/c1-7-20(8-2)15(5,6)13(19-16)9-14-17-11-18-21(14)10-12(3)4/h11-13,19H,7-10,16H2,1-6H3 |
| InChIKey | VCTDJWMTKJRAEI-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 72.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.46 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|