C10H22N6 — CID 105238923
3-hydrazinyl-N,N,2-trimethyl-4-(2-methyl-1,2,4-triazol-3-yl)butan-2-amine (PubChem CID 105238923) has the molecular formula C10H22N6 and a molecular weight of 226.33 g/mol. Its IUPAC name is 3-hydrazinyl-N,N,2-trimethyl-4-(2-methyl-1,2,4-triazol-3-yl)butan-2-amine.
| Compound Name | 3-hydrazinyl-N,N,2-trimethyl-4-(2-methyl-1,2,4-triazol-3-yl)butan-2-amine |
|---|---|
| PubChem CID | 105238923 |
| Molecular Formula | C10H22N6 |
| Molecular Weight | 226.33 g/mol |
| Exact Mass | 226.19 |
| IUPAC Name | 3-hydrazinyl-N,N,2-trimethyl-4-(2-methyl-1,2,4-triazol-3-yl)butan-2-amine |
| SMILES | CN(C)C(C)(C)C(Cc1ncnn1C)NN |
| InChI | InChI=1S/C10H22N6/c1-10(2,15(3)4)8(14-11)6-9-12-7-13-16(9)5/h7-8,14H,6,11H2,1-5H3 |
| InChIKey | JAUXUWBOFDIFMM-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 72.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.33 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|