About 2-fluoro-3-(2-methyl-1,2,4-triazol-3-yl)propan-1-amine
2-fluoro-3-(2-methyl-1,2,4-triazol-3-yl)propan-1-amine (PubChem CID 112562610) has the molecular formula C6H11FN4
and a molecular weight of 158.18 g/mol. Its IUPAC name is 2-fluoro-3-(2-methyl-1,2,4-triazol-3-yl)propan-1-amine.
Analyze 2-fluoro-3-(2-methyl-1,2,4-triazol-3-yl)propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-3-(2-methyl-1,2,4-triazol-3-yl)propan-1-amine?
The IUPAC name of 2-fluoro-3-(2-methyl-1,2,4-triazol-3-yl)propan-1-amine (CID 112562610) is 2-fluoro-3-(2-methyl-1,2,4-triazol-3-yl)propan-1-amine.
What is the SMILES notation for 2-fluoro-3-(2-methyl-1,2,4-triazol-3-yl)propan-1-amine?
The canonical SMILES for 2-fluoro-3-(2-methyl-1,2,4-triazol-3-yl)propan-1-amine is Cn1ncnc1CC(F)CN.
What is the InChIKey of 2-fluoro-3-(2-methyl-1,2,4-triazol-3-yl)propan-1-amine?
The InChIKey is LVUODBMAHZYQDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11FN4/c1-11-6(9-4-10-11)2-5(7)3-8/h4-5H,2-3,8H2,1H3.
What are the key properties of 2-fluoro-3-(2-methyl-1,2,4-triazol-3-yl)propan-1-amine?
2-fluoro-3-(2-methyl-1,2,4-triazol-3-yl)propan-1-amine has a molecular weight of 158.18 g/mol, XLogP of -0.35, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-3-(2-methyl-1,2,4-triazol-3-yl)propan-1-amine is sourced from PubChem (CID 112562610), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).