C12H24N4 — CID 104997891
1-(2-methyl-1,2,4-triazol-3-yl)-3-propylhexan-2-amine (PubChem CID 104997891) has the molecular formula C12H24N4 and a molecular weight of 224.35 g/mol. Its IUPAC name is 1-(2-methyl-1,2,4-triazol-3-yl)-3-propylhexan-2-amine.
| Compound Name | 1-(2-methyl-1,2,4-triazol-3-yl)-3-propylhexan-2-amine |
|---|---|
| PubChem CID | 104997891 |
| Molecular Formula | C12H24N4 |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.20 |
| IUPAC Name | 1-(2-methyl-1,2,4-triazol-3-yl)-3-propylhexan-2-amine |
| SMILES | CCCC(CCC)C(N)Cc1ncnn1C |
| InChI | InChI=1S/C12H24N4/c1-4-6-10(7-5-2)11(13)8-12-14-9-15-16(12)3/h9-11H,4-8,13H2,1-3H3 |
| InChIKey | PAUADLWOOGZZQT-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |