C9H21N3 — CID 164877506
ethane;5-ethyl-1-methyl-1,2,4-triazole (PubChem CID 164877506) has the molecular formula C9H21N3 and a molecular weight of 171.29 g/mol. Its IUPAC name is ethane;5-ethyl-1-methyl-1,2,4-triazole.
| Compound Name | ethane;5-ethyl-1-methyl-1,2,4-triazole |
|---|---|
| PubChem CID | 164877506 |
| Molecular Formula | C9H21N3 |
| Molecular Weight | 171.29 g/mol |
| Exact Mass | 171.17 |
| IUPAC Name | ethane;5-ethyl-1-methyl-1,2,4-triazole |
| SMILES | CC.CC.CCc1ncnn1C |
| InChI | InChI=1S/C5H9N3.2C2H6/c1-3-5-6-4-7-8(5)2;2*1-2/h4H,3H2,1-2H3;2*1-2H3 |
| InChIKey | YIQSKWZBQDPZLQ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.29 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |