C8H15IN4 — CID 106844460
4-iodo-N-[(2-methyl-1,2,4-triazol-3-yl)methyl]butan-1-amine (PubChem CID 106844460) has the molecular formula C8H15IN4 and a molecular weight of 294.14 g/mol. Its IUPAC name is 4-iodo-N-[(2-methyl-1,2,4-triazol-3-yl)methyl]butan-1-amine.
| Compound Name | 4-iodo-N-[(2-methyl-1,2,4-triazol-3-yl)methyl]butan-1-amine |
|---|---|
| PubChem CID | 106844460 |
| Molecular Formula | C8H15IN4 |
| Molecular Weight | 294.14 g/mol |
| Exact Mass | 294.03 |
| IUPAC Name | 4-iodo-N-[(2-methyl-1,2,4-triazol-3-yl)methyl]butan-1-amine |
| SMILES | Cn1ncnc1CNCCCCI |
| InChI | InChI=1S/C8H15IN4/c1-13-8(11-7-12-13)6-10-5-3-2-4-9/h7,10H,2-6H2,1H3 |
| InChIKey | NCGKPCVMWXZRAS-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.14 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|