C10H16N4 — CID 106211368
N-[(2-methyl-1,2,4-triazol-3-yl)methyl]hex-5-yn-1-amine (PubChem CID 106211368) has the molecular formula C10H16N4 and a molecular weight of 192.27 g/mol. Its IUPAC name is N-[(2-methyl-1,2,4-triazol-3-yl)methyl]hex-5-yn-1-amine.
| Compound Name | N-[(2-methyl-1,2,4-triazol-3-yl)methyl]hex-5-yn-1-amine |
|---|---|
| PubChem CID | 106211368 |
| Molecular Formula | C10H16N4 |
| Molecular Weight | 192.27 g/mol |
| Exact Mass | 192.14 |
| IUPAC Name | N-[(2-methyl-1,2,4-triazol-3-yl)methyl]hex-5-yn-1-amine |
| SMILES | C#CCCCCNCc1ncnn1C |
| InChI | InChI=1S/C10H16N4/c1-3-4-5-6-7-11-8-10-12-9-13-14(10)2/h1,9,11H,4-8H2,2H3 |
| InChIKey | XQKBYUZPZQNSLK-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.27 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|