C9H18N4O — CID 107317324
5-[(2-methyl-1,2,4-triazol-3-yl)methylamino]pentan-1-ol (PubChem CID 107317324) has the molecular formula C9H18N4O and a molecular weight of 198.27 g/mol. Its IUPAC name is 5-[(2-methyl-1,2,4-triazol-3-yl)methylamino]pentan-1-ol.
| Compound Name | 5-[(2-methyl-1,2,4-triazol-3-yl)methylamino]pentan-1-ol |
|---|---|
| PubChem CID | 107317324 |
| Molecular Formula | C9H18N4O |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.15 |
| IUPAC Name | 5-[(2-methyl-1,2,4-triazol-3-yl)methylamino]pentan-1-ol |
| SMILES | Cn1ncnc1CNCCCCCO |
| InChI | InChI=1S/C9H18N4O/c1-13-9(11-8-12-13)7-10-5-3-2-4-6-14/h8,10,14H,2-7H2,1H3 |
| InChIKey | VSQIQTUMLAPFDI-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|