C9H18N4O2 — CID 106246462
1-methoxy-4-[(2-methyl-1,2,4-triazol-3-yl)methylamino]butan-2-ol (PubChem CID 106246462) has the molecular formula C9H18N4O2 and a molecular weight of 214.27 g/mol. Its IUPAC name is 1-methoxy-4-[(2-methyl-1,2,4-triazol-3-yl)methylamino]butan-2-ol.
| Compound Name | 1-methoxy-4-[(2-methyl-1,2,4-triazol-3-yl)methylamino]butan-2-ol |
|---|---|
| PubChem CID | 106246462 |
| Molecular Formula | C9H18N4O2 |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.14 |
| IUPAC Name | 1-methoxy-4-[(2-methyl-1,2,4-triazol-3-yl)methylamino]butan-2-ol |
| SMILES | COCC(O)CCNCc1ncnn1C |
| InChI | InChI=1S/C9H18N4O2/c1-13-9(11-7-12-13)5-10-4-3-8(14)6-15-2/h7-8,10,14H,3-6H2,1-2H3 |
| InChIKey | TXOAGMZBDBKXOU-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|