C7H13N5O2 — CID 83211857
2-[(2-methyl-1,2,4-triazol-3-yl)methylamino]ethyl carbamate (PubChem CID 83211857) has the molecular formula C7H13N5O2 and a molecular weight of 199.21 g/mol. Its IUPAC name is 2-[(2-methyl-1,2,4-triazol-3-yl)methylamino]ethyl carbamate.
| Compound Name | 2-[(2-methyl-1,2,4-triazol-3-yl)methylamino]ethyl carbamate |
|---|---|
| PubChem CID | 83211857 |
| Molecular Formula | C7H13N5O2 |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.11 |
| IUPAC Name | 2-[(2-methyl-1,2,4-triazol-3-yl)methylamino]ethyl carbamate |
| SMILES | Cn1ncnc1CNCCOC(N)=O |
| InChI | InChI=1S/C7H13N5O2/c1-12-6(10-5-11-12)4-9-2-3-14-7(8)13/h5,9H,2-4H2,1H3,(H2,8,13) |
| InChIKey | ZAXKOPMYDVFCGL-UHFFFAOYSA-N |
| XLogP | -1.00 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|