About 2-[2-[(2-propan-2-yl-1,2,4-triazol-3-yl)methylamino]ethoxy]acetamide
2-[2-[(2-propan-2-yl-1,2,4-triazol-3-yl)methylamino]ethoxy]acetamide (PubChem CID 106237724) has the molecular formula C10H19N5O2
and a molecular weight of 241.29 g/mol. Its IUPAC name is 2-[2-[(2-propan-2-yl-1,2,4-triazol-3-yl)methylamino]ethoxy]acetamide.
Molecular Properties
| Compound Name | 2-[2-[(2-propan-2-yl-1,2,4-triazol-3-yl)methylamino]ethoxy]acetamide |
| PubChem CID | 106237724 |
| Molecular Formula | C10H19N5O2 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.15 |
| IUPAC Name | 2-[2-[(2-propan-2-yl-1,2,4-triazol-3-yl)methylamino]ethoxy]acetamide |
| SMILES | CC(C)n1ncnc1CNCCOCC(N)=O |
| InChI | InChI=1S/C10H19N5O2/c1-8(2)15-10(13-7-14-15)5-12-3-4-17-6-9(11)16/h7-8,12H,3-6H2,1-2H3,(H2,11,16) |
| InChIKey | RNRQTIMXWFUFGP-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-[(2-propan-2-yl-1,2,4-triazol-3-yl)methylamino]ethoxy]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[(2-propan-2-yl-1,2,4-triazol-3-yl)methylamino]ethoxy]acetamide?
The IUPAC name of 2-[2-[(2-propan-2-yl-1,2,4-triazol-3-yl)methylamino]ethoxy]acetamide (CID 106237724) is 2-[2-[(2-propan-2-yl-1,2,4-triazol-3-yl)methylamino]ethoxy]acetamide.
What is the SMILES notation for 2-[2-[(2-propan-2-yl-1,2,4-triazol-3-yl)methylamino]ethoxy]acetamide?
The canonical SMILES for 2-[2-[(2-propan-2-yl-1,2,4-triazol-3-yl)methylamino]ethoxy]acetamide is CC(C)n1ncnc1CNCCOCC(N)=O.
What is the InChIKey of 2-[2-[(2-propan-2-yl-1,2,4-triazol-3-yl)methylamino]ethoxy]acetamide?
The InChIKey is RNRQTIMXWFUFGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19N5O2/c1-8(2)15-10(13-7-14-15)5-12-3-4-17-6-9(11)16/h7-8,12H,3-6H2,1-2H3,(H2,11,16).
What are the key properties of 2-[2-[(2-propan-2-yl-1,2,4-triazol-3-yl)methylamino]ethoxy]acetamide?
2-[2-[(2-propan-2-yl-1,2,4-triazol-3-yl)methylamino]ethoxy]acetamide has a molecular weight of 241.29 g/mol, XLogP of -0.55, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[(2-propan-2-yl-1,2,4-triazol-3-yl)methylamino]ethoxy]acetamide is sourced from PubChem (CID 106237724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).