C12H22N4O2 — CID 106237971
2-[2-[(1-butan-2-ylpyrazol-3-yl)methylamino]ethoxy]acetamide (PubChem CID 106237971) has the molecular formula C12H22N4O2 and a molecular weight of 254.33 g/mol. Its IUPAC name is 2-[2-[(1-butan-2-ylpyrazol-3-yl)methylamino]ethoxy]acetamide.
| Compound Name | 2-[2-[(1-butan-2-ylpyrazol-3-yl)methylamino]ethoxy]acetamide |
|---|---|
| PubChem CID | 106237971 |
| Molecular Formula | C12H22N4O2 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.17 |
| IUPAC Name | 2-[2-[(1-butan-2-ylpyrazol-3-yl)methylamino]ethoxy]acetamide |
| SMILES | CCC(C)n1ccc(CNCCOCC(N)=O)n1 |
| InChI | InChI=1S/C12H22N4O2/c1-3-10(2)16-6-4-11(15-16)8-14-5-7-18-9-12(13)17/h4,6,10,14H,3,5,7-9H2,1-2H3,(H2,13,17) |
| InChIKey | FZXVYKMONCXTBU-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 82.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|