C9H15ClN4O — CID 146107348
2-chloro-N-[(2-propan-2-yl-1,2,4-triazol-3-yl)methyl]propanamide (PubChem CID 146107348) has the molecular formula C9H15ClN4O and a molecular weight of 230.70 g/mol. Its IUPAC name is 2-chloro-N-[(2-propan-2-yl-1,2,4-triazol-3-yl)methyl]propanamide.
| Compound Name | 2-chloro-N-[(2-propan-2-yl-1,2,4-triazol-3-yl)methyl]propanamide |
|---|---|
| PubChem CID | 146107348 |
| Molecular Formula | C9H15ClN4O |
| Molecular Weight | 230.70 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | 2-chloro-N-[(2-propan-2-yl-1,2,4-triazol-3-yl)methyl]propanamide |
| SMILES | CC(Cl)C(=O)NCc1ncnn1C(C)C |
| InChI | InChI=1S/C9H15ClN4O/c1-6(2)14-8(12-5-13-14)4-11-9(15)7(3)10/h5-7H,4H2,1-3H3,(H,11,15) |
| InChIKey | CHMOAKPZLWEQQF-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.70 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|