(2S)-2-amino-3-(2-propan-2-yl-1,2,4-triazol-3-yl)propanoic acid

C8H14N4O2 — CID 106702633

IUPAC(2S)-2-amino-3-(2-propan-2-yl-1,2,4-triazol-3-yl)propanoic acid
SMILESCC(C)n1ncnc1C[C@H](N)C(=O)O
InChIInChI=1S/C8H14N4O2/c1-5(2)12-7(10-4-11-12)3-6(9)8(13)14/h4-6H,3,9H2,1-2H3,(H,13,14)/t6-/m0/s1
InChIKeyAFIVVFBSYGDDHA-LURJTMIESA-N
MW198.23 g/mol
LogP-0.19
Rot. Bonds4

About (2S)-2-amino-3-(2-propan-2-yl-1,2,4-triazol-3-yl)propanoic acid

(2S)-2-amino-3-(2-propan-2-yl-1,2,4-triazol-3-yl)propanoic acid (PubChem CID 106702633) has the molecular formula C8H14N4O2 and a molecular weight of 198.23 g/mol. Its IUPAC name is (2S)-2-amino-3-(2-propan-2-yl-1,2,4-triazol-3-yl)propanoic acid.

Molecular Properties

Compound Name(2S)-2-amino-3-(2-propan-2-yl-1,2,4-triazol-3-yl)propanoic acid
PubChem CID106702633
Molecular FormulaC8H14N4O2
Molecular Weight198.23 g/mol
Exact Mass198.11
IUPAC Name(2S)-2-amino-3-(2-propan-2-yl-1,2,4-triazol-3-yl)propanoic acid
SMILESCC(C)n1ncnc1C[C@H](N)C(=O)O
InChIInChI=1S/C8H14N4O2/c1-5(2)12-7(10-4-11-12)3-6(9)8(13)14/h4-6H,3,9H2,1-2H3,(H,13,14)/t6-/m0/s1
InChIKeyAFIVVFBSYGDDHA-LURJTMIESA-N
XLogP-0.19
TPSA94.03 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500198.23
LogP ≤ 5-0.19
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze (2S)-2-amino-3-(2-propan-2-yl-1,2,4-triazol-3-yl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S)-2-amino-3-(2-propan-2-yl-1,2,4-triazol-3-yl)propanoic acid?
The IUPAC name of (2S)-2-amino-3-(2-propan-2-yl-1,2,4-triazol-3-yl)propanoic acid (CID 106702633) is (2S)-2-amino-3-(2-propan-2-yl-1,2,4-triazol-3-yl)propanoic acid.
What is the SMILES notation for (2S)-2-amino-3-(2-propan-2-yl-1,2,4-triazol-3-yl)propanoic acid?
The canonical SMILES for (2S)-2-amino-3-(2-propan-2-yl-1,2,4-triazol-3-yl)propanoic acid is CC(C)n1ncnc1C[C@H](N)C(=O)O.
What is the InChIKey of (2S)-2-amino-3-(2-propan-2-yl-1,2,4-triazol-3-yl)propanoic acid?
The InChIKey is AFIVVFBSYGDDHA-LURJTMIESA-N. The full InChI is InChI=1S/C8H14N4O2/c1-5(2)12-7(10-4-11-12)3-6(9)8(13)14/h4-6H,3,9H2,1-2H3,(H,13,14)/t6-/m0/s1.
What are the key properties of (2S)-2-amino-3-(2-propan-2-yl-1,2,4-triazol-3-yl)propanoic acid?
(2S)-2-amino-3-(2-propan-2-yl-1,2,4-triazol-3-yl)propanoic acid has a molecular weight of 198.23 g/mol, XLogP of -0.19, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-amino-3-(2-propan-2-yl-1,2,4-triazol-3-yl)propanoic acid is sourced from PubChem (CID 106702633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).